C10H7NO4 — CID 73116628
2-cyano-3-(3,5-dihydroxyphenyl)prop-2-enoic acid (PubChem CID 73116628) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-cyano-3-(3,5-dihydroxyphenyl)prop-2-enoic acid.
| Compound Name | 2-cyano-3-(3,5-dihydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 73116628 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-cyano-3-(3,5-dihydroxyphenyl)prop-2-enoic acid |
| SMILES | N#CC(=Cc1cc(O)cc(O)c1)C(=O)O |
| InChI | InChI=1S/C10H7NO4/c11-5-7(10(14)15)1-6-2-8(12)4-9(13)3-6/h1-4,12-13H,(H,14,15) |
| InChIKey | ANFPQURAKOSATN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|