C10H9NO10P2 — CID 123202965
2-cyano-3-(3,4-diphosphonooxyphenyl)prop-2-enoic acid (PubChem CID 123202965) has the molecular formula C10H9NO10P2 and a molecular weight of 365.13 g/mol. Its IUPAC name is 2-cyano-3-(3,4-diphosphonooxyphenyl)prop-2-enoic acid.
| Compound Name | 2-cyano-3-(3,4-diphosphonooxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123202965 |
| Molecular Formula | C10H9NO10P2 |
| Molecular Weight | 365.13 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-cyano-3-(3,4-diphosphonooxyphenyl)prop-2-enoic acid |
| SMILES | N#CC(=Cc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1)C(=O)O |
| InChI | InChI=1S/C10H9NO10P2/c11-5-7(10(12)13)3-6-1-2-8(20-22(14,15)16)9(4-6)21-23(17,18)19/h1-4H,(H,12,13)(H2,14,15,16)(H2,17,18,19) |
| InChIKey | BFQSORZNROCYNG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 194.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.13 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|