C10H8N2O4 — CID 145215241
(E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyanoprop-2-enoic acid (PubChem CID 145215241) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 145215241 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1cc(N)c(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H8N2O4/c11-4-6(10(15)16)1-5-2-7(12)9(14)8(13)3-5/h1-3,13-14H,12H2,(H,15,16)/b6-1+ |
| InChIKey | CIWSLIPIWXANSE-LZCJLJQNSA-N |
| XLogP | 0.67 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|