C26H26N4O8 — CID 11577260
(E)-2-cyano-N-[6-[[(E)-2-cyano-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]hexyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide (PubChem CID 11577260) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is (E)-2-cyano-N-[6-[[(E)-2-cyano-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]hexyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[6-[[(E)-2-cyano-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]hexyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11577260 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (E)-2-cyano-N-[6-[[(E)-2-cyano-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]hexyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(O)c1)C(=O)NCCCCCCNC(=O)/C(C#N)=C/c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C26H26N4O8/c27-13-17(7-15-9-19(31)23(35)20(32)10-15)25(37)29-5-3-1-2-4-6-30-26(38)18(14-28)8-16-11-21(33)24(36)22(34)12-16/h7-12,31-36H,1-6H2,(H,29,37)(H,30,38)/b17-7+,18-8+ |
| InChIKey | RKAWPPGSQKWAKM-ZEELXFFVSA-N |
| XLogP | 2.23 |
| TPSA | 227.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|