C16H18N2O7S — CID 76835658
6-[[2-cyano-3-(4-hydroxy-3-sulfophenyl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 76835658) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is 6-[[2-cyano-3-(4-hydroxy-3-sulfophenyl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[2-cyano-3-(4-hydroxy-3-sulfophenyl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 76835658 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-[[2-cyano-3-(4-hydroxy-3-sulfophenyl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | N#CC(=Cc1ccc(O)c(S(=O)(=O)O)c1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C16H18N2O7S/c17-10-12(16(22)18-7-3-1-2-4-15(20)21)8-11-5-6-13(19)14(9-11)26(23,24)25/h5-6,8-9,19H,1-4,7H2,(H,18,22)(H,20,21)(H,23,24,25) |
| InChIKey | BFFJBZSGYPDYFE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|