C27H25N3O4 — CID 72623268
phenyl N-[5-[2-cyano-3-oxo-3-(4-phenylbutylamino)prop-1-enyl]-2-hydroxyphenyl]carbamate (PubChem CID 72623268) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is phenyl N-[5-[2-cyano-3-oxo-3-(4-phenylbutylamino)prop-1-enyl]-2-hydroxyphenyl]carbamate.
| Compound Name | phenyl N-[5-[2-cyano-3-oxo-3-(4-phenylbutylamino)prop-1-enyl]-2-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 72623268 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | phenyl N-[5-[2-cyano-3-oxo-3-(4-phenylbutylamino)prop-1-enyl]-2-hydroxyphenyl]carbamate |
| SMILES | N#CC(=Cc1ccc(O)c(NC(=O)Oc2ccccc2)c1)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O4/c28-19-22(26(32)29-16-8-7-11-20-9-3-1-4-10-20)17-21-14-15-25(31)24(18-21)30-27(33)34-23-12-5-2-6-13-23/h1-6,9-10,12-15,17-18,31H,7-8,11,16H2,(H,29,32)(H,30,33) |
| InChIKey | NQFZIQIBPKKDIS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|