C25H20N4O6 — CID 11340416
4-[(E)-3-[3-[[(E)-3-(4-carboxyphenyl)-2-cyanoprop-2-enoyl]amino]propylamino]-2-cyano-3-oxoprop-1-enyl]benzoic acid (PubChem CID 11340416) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is 4-[(E)-3-[3-[[(E)-3-(4-carboxyphenyl)-2-cyanoprop-2-enoyl]amino]propylamino]-2-cyano-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[3-[[(E)-3-(4-carboxyphenyl)-2-cyanoprop-2-enoyl]amino]propylamino]-2-cyano-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 11340416 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-[(E)-3-[3-[[(E)-3-(4-carboxyphenyl)-2-cyanoprop-2-enoyl]amino]propylamino]-2-cyano-3-oxoprop-1-enyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(C(=O)O)cc1)C(=O)NCCCNC(=O)/C(C#N)=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H20N4O6/c26-14-20(12-16-2-6-18(7-3-16)24(32)33)22(30)28-10-1-11-29-23(31)21(15-27)13-17-4-8-19(9-5-17)25(34)35/h2-9,12-13H,1,10-11H2,(H,28,30)(H,29,31)(H,32,33)(H,34,35)/b20-12+,21-13+ |
| InChIKey | SGZOAEDQFHZHFU-ZIOPAAQOSA-N |
| XLogP | 2.22 |
| TPSA | 180.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|