C18H24N2O2 — CID 3749505
3-(4-tert-butylphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 3749505) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 3749505 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)C(C#N)=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-18(2,3)16-8-6-14(7-9-16)12-15(13-19)17(21)20-10-5-11-22-4/h6-9,12H,5,10-11H2,1-4H3,(H,20,21) |
| InChIKey | FJZKSNQDDQONSD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|