C17H16F6N2O3 — CID 78785035
(E)-2-cyano-3-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 78785035) has the molecular formula C17H16F6N2O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 78785035 |
| Molecular Formula | C17H16F6N2O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (E)-2-cyano-3-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)/C(C#N)=C/c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F6N2O3/c1-27-8-2-7-25-14(26)12(10-24)9-11-3-5-13(6-4-11)28-17(22,23)15(18)16(19,20)21/h3-6,9,15H,2,7-8H2,1H3,(H,25,26)/b12-9+ |
| InChIKey | QJKCVKKXYUKKPP-FMIVXFBMSA-N |
| XLogP | 3.62 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|