C17H9F6NO3 — CID 9335802
(E)-2-(furan-2-carbonyl)-3-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enenitrile (PubChem CID 9335802) has the molecular formula C17H9F6NO3 and a molecular weight of 389.25 g/mol. Its IUPAC name is (E)-2-(furan-2-carbonyl)-3-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(furan-2-carbonyl)-3-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9335802 |
| Molecular Formula | C17H9F6NO3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (E)-2-(furan-2-carbonyl)-3-[4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OC(F)(F)[C@@H](F)C(F)(F)F)cc1)C(=O)c1ccco1 |
| InChI | InChI=1S/C17H9F6NO3/c18-15(16(19,20)21)17(22,23)27-12-5-3-10(4-6-12)8-11(9-24)14(25)13-2-1-7-26-13/h1-8,15H/b11-8+/t15-/m0/s1 |
| InChIKey | PXXHPKAEHSQRFW-SHQCLWGWSA-N |
| XLogP | 4.94 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|