C16H13NO4 — CID 9335407
(E)-3-(3,4-dimethoxyphenyl)-2-(furan-2-carbonyl)prop-2-enenitrile (PubChem CID 9335407) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-2-(furan-2-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-2-(furan-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9335407 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-2-(furan-2-carbonyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C16H13NO4/c1-19-13-6-5-11(9-15(13)20-2)8-12(10-17)16(18)14-4-3-7-21-14/h3-9H,1-2H3/b12-8+ |
| InChIKey | HXOGPYUCQGAYCR-XYOKQWHBSA-N |
| XLogP | 3.09 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|