C16H12N2O3 — CID 9335339
N-[4-[(E)-2-cyano-3-(furan-2-yl)-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 9335339) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is N-[4-[(E)-2-cyano-3-(furan-2-yl)-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-2-cyano-3-(furan-2-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9335339 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-[4-[(E)-2-cyano-3-(furan-2-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C(\C#N)C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H12N2O3/c1-11(19)18-14-6-4-12(5-7-14)9-13(10-17)16(20)15-3-2-8-21-15/h2-9H,1H3,(H,18,19)/b13-9+ |
| InChIKey | DOTOZWBYOOUZMJ-UKTHLTGXSA-N |
| XLogP | 3.03 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|