C20H16N2O5S — CID 88616772
benzenesulfonate;(E)-2-(furan-2-carbonyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile (PubChem CID 88616772) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is benzenesulfonate;(E)-2-(furan-2-carbonyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile.
| Compound Name | benzenesulfonate;(E)-2-(furan-2-carbonyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 88616772 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | benzenesulfonate;(E)-2-(furan-2-carbonyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile |
| SMILES | C[n+]1ccc(/C=C(\C#N)C(=O)c2ccco2)cc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C14H11N2O2.C6H6O3S/c1-16-6-4-11(5-7-16)9-12(10-15)14(17)13-3-2-8-18-13;7-10(8,9)6-4-2-1-3-5-6/h2-9H,1H3;1-5H,(H,7,8,9)/q+1;/p-1/b12-9+; |
| InChIKey | QRUFPADZRPSOGM-NBYYMMLRSA-M |
| XLogP | 2.48 |
| TPSA | 115.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|