C10H5ClN2O5 — CID 76532835
2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoyl chloride (PubChem CID 76532835) has the molecular formula C10H5ClN2O5 and a molecular weight of 268.61 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoyl chloride.
| Compound Name | 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 76532835 |
| Molecular Formula | C10H5ClN2O5 |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoyl chloride |
| SMILES | N#CC(=Cc1cc(O)c(O)c([N+](=O)[O-])c1)C(=O)Cl |
| InChI | InChI=1S/C10H5ClN2O5/c11-10(16)6(4-12)1-5-2-7(13(17)18)9(15)8(14)3-5/h1-3,14-15H |
| InChIKey | BGQFUNSSOQVJFL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|