C14H10N3O5+ — CID 145215170
(Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(1-hydroxypyridin-1-ium-4-yl)prop-2-enenitrile (PubChem CID 145215170) has the molecular formula C14H10N3O5+ and a molecular weight of 300.25 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(1-hydroxypyridin-1-ium-4-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(1-hydroxypyridin-1-ium-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 145215170 |
| Molecular Formula | C14H10N3O5+ |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(1-hydroxypyridin-1-ium-4-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(O)c(O)c([N+](=O)[O-])c1)c1cc[n+](O)cc1 |
| InChI | InChI=1S/C14H9N3O5/c15-8-11(10-1-3-16(20)4-2-10)5-9-6-12(17(21)22)14(19)13(18)7-9/h1-7,18,20H/p+1 |
| InChIKey | BOZLCEIQZFLBGO-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|