C15H8F3N3O5 — CID 69253879
(E)-2-(3,4-dihydroxy-5-nitrophenyl)-3-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile (PubChem CID 69253879) has the molecular formula C15H8F3N3O5 and a molecular weight of 367.24 g/mol. Its IUPAC name is (E)-2-(3,4-dihydroxy-5-nitrophenyl)-3-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(3,4-dihydroxy-5-nitrophenyl)-3-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 69253879 |
| Molecular Formula | C15H8F3N3O5 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (E)-2-(3,4-dihydroxy-5-nitrophenyl)-3-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(C(F)(F)F)c[n+]([O-])c1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8F3N3O5/c16-15(17,18)11-2-8(6-20(24)7-11)1-10(5-19)9-3-12(21(25)26)14(23)13(22)4-9/h1-4,6-7,22-23H/b10-1- |
| InChIKey | IJYHZFBAPGCJBH-LAFDYMOFSA-N |
| XLogP | 2.72 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|