C16H11BrClN3O5 — CID 87244595
(Z)-2-(2-bromo-5-chloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enenitrile (PubChem CID 87244595) has the molecular formula C16H11BrClN3O5 and a molecular weight of 440.64 g/mol. Its IUPAC name is (Z)-2-(2-bromo-5-chloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(2-bromo-5-chloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 87244595 |
| Molecular Formula | C16H11BrClN3O5 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | (Z)-2-(2-bromo-5-chloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1c(Cl)c(C)[n+]([O-])c(Br)c1/C(C#N)=C/c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11BrClN3O5/c1-7-13(16(17)20(24)8(2)14(7)18)10(6-19)3-9-4-11(21(25)26)15(23)12(22)5-9/h3-5,22-23H,1-2H3/b10-3+ |
| InChIKey | QGFXFQUPCIMVKY-XCVCLJGOSA-N |
| XLogP | 3.74 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|