C16H21N3O5 — CID 143608893
acetonitrile;(E)-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-methylprop-2-enamide (PubChem CID 143608893) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is acetonitrile;(E)-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-methylprop-2-enamide.
| Compound Name | acetonitrile;(E)-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 143608893 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | acetonitrile;(E)-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-methylprop-2-enamide |
| SMILES | CC#N.CCN(CC)C(=O)/C(C)=C/c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N2O5.C2H3N/c1-4-15(5-2)14(19)9(3)6-10-7-11(16(20)21)13(18)12(17)8-10;1-2-3/h6-8,17-18H,4-5H2,1-3H3;1H3/b9-6+; |
| InChIKey | GOYMAEUUTIPWJU-MLBSPLJJSA-N |
| XLogP | 2.81 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|