C19H23N3O6 — CID 50898441
[4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-6-nitrophenyl] pentanoate (PubChem CID 50898441) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-6-nitrophenyl] pentanoate.
| Compound Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-6-nitrophenyl] pentanoate |
|---|---|
| PubChem CID | 50898441 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-6-nitrophenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(O)cc(/C=C(\C#N)C(=O)N(CC)CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O6/c1-4-7-8-17(24)28-18-15(22(26)27)10-13(11-16(18)23)9-14(12-20)19(25)21(5-2)6-3/h9-11,23H,4-8H2,1-3H3/b14-9+ |
| InChIKey | QIGGVGWOMHMLSD-NTEUORMPSA-N |
| XLogP | 3.17 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|