C22H23N3O9 — CID 59720280
[4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-prop-1-en-2-yloxycarbonyloxyphenyl] prop-1-en-2-yl carbonate (PubChem CID 59720280) has the molecular formula C22H23N3O9 and a molecular weight of 473.44 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-prop-1-en-2-yloxycarbonyloxyphenyl] prop-1-en-2-yl carbonate.
| Compound Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-prop-1-en-2-yloxycarbonyloxyphenyl] prop-1-en-2-yl carbonate |
|---|---|
| PubChem CID | 59720280 |
| Molecular Formula | C22H23N3O9 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-prop-1-en-2-yloxycarbonyloxyphenyl] prop-1-en-2-yl carbonate |
| SMILES | C=C(C)OC(=O)Oc1cc(/C=C(\C#N)C(=O)N(CC)CC)cc([N+](=O)[O-])c1OC(=O)OC(=C)C |
| InChI | InChI=1S/C22H23N3O9/c1-7-24(8-2)20(26)16(12-23)9-15-10-17(25(29)30)19(34-22(28)32-14(5)6)18(11-15)33-21(27)31-13(3)4/h9-11H,3,5,7-8H2,1-2,4,6H3/b16-9+ |
| InChIKey | BOFDERUTFQEBKI-CXUHLZMHSA-N |
| XLogP | 4.47 |
| TPSA | 158.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|