C21H27N3O7 — CID 69404961
[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] hexan-3-yl carbonate (PubChem CID 69404961) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] hexan-3-yl carbonate.
| Compound Name | [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] hexan-3-yl carbonate |
|---|---|
| PubChem CID | 69404961 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] hexan-3-yl carbonate |
| SMILES | CCCC(CC)OC(=O)Oc1cc(C=C(C#N)C(=O)N(CC)CC)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C21H27N3O7/c1-5-9-16(6-2)30-21(27)31-18-12-14(11-17(19(18)25)24(28)29)10-15(13-22)20(26)23(7-3)8-4/h10-12,16,25H,5-9H2,1-4H3 |
| InChIKey | SLYZNXKMATUESF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|