C23H29N3O7 — CID 25008883
[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (2,5-dimethylcyclohexyl) carbonate (PubChem CID 25008883) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (2,5-dimethylcyclohexyl) carbonate.
| Compound Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (2,5-dimethylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 25008883 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (2,5-dimethylcyclohexyl) carbonate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)OC2CC(C)CCC2C)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N3O7/c1-5-25(6-2)22(28)17(13-24)10-16-11-18(26(30)31)21(27)20(12-16)33-23(29)32-19-9-14(3)7-8-15(19)4/h10-12,14-15,19,27H,5-9H2,1-4H3/b17-10+ |
| InChIKey | QXFXAULOSILNMH-LICLKQGHSA-N |
| XLogP | 4.42 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|