C21H23N3O9 — CID 59720271
[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-methyl-2-oxooxan-4-yl) carbonate (PubChem CID 59720271) has the molecular formula C21H23N3O9 and a molecular weight of 461.43 g/mol. Its IUPAC name is [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-methyl-2-oxooxan-4-yl) carbonate.
| Compound Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-methyl-2-oxooxan-4-yl) carbonate |
|---|---|
| PubChem CID | 59720271 |
| Molecular Formula | C21H23N3O9 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-methyl-2-oxooxan-4-yl) carbonate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)OC2(C)CCOC(=O)C2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O9/c1-4-23(5-2)19(27)14(12-22)8-13-9-15(24(29)30)18(26)16(10-13)32-20(28)33-21(3)6-7-31-17(25)11-21/h8-10,26H,4-7,11H2,1-3H3/b14-8+ |
| InChIKey | CSAUGPPFXNPSBB-RIYZIHGNSA-N |
| XLogP | 2.69 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|