C30H35N3O9 — CID 69249538
octyl 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybenzoate (PubChem CID 69249538) has the molecular formula C30H35N3O9 and a molecular weight of 581.62 g/mol. Its IUPAC name is octyl 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybenzoate.
| Compound Name | octyl 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybenzoate |
|---|---|
| PubChem CID | 69249538 |
| Molecular Formula | C30H35N3O9 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | octyl 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybenzoate |
| SMILES | CCCCCCCCOC(=O)c1ccccc1OC(=O)Oc1cc(C=C(C#N)C(=O)N(CC)CC)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C30H35N3O9/c1-4-7-8-9-10-13-16-40-29(36)23-14-11-12-15-25(23)41-30(37)42-26-19-21(18-24(27(26)34)33(38)39)17-22(20-31)28(35)32(5-2)6-3/h11-12,14-15,17-19,34H,4-10,13,16H2,1-3H3 |
| InChIKey | FAOXSWGBYKLVDG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|