C21H23N3O11 — CID 59720284
dimethyl 2-[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybutanedioate (PubChem CID 59720284) has the molecular formula C21H23N3O11 and a molecular weight of 493.43 g/mol. Its IUPAC name is dimethyl 2-[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybutanedioate.
| Compound Name | dimethyl 2-[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybutanedioate |
|---|---|
| PubChem CID | 59720284 |
| Molecular Formula | C21H23N3O11 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | dimethyl 2-[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxybutanedioate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)OC(CC(=O)OC)C(=O)OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O11/c1-5-23(6-2)19(27)13(11-22)7-12-8-14(24(30)31)18(26)15(9-12)34-21(29)35-16(20(28)33-4)10-17(25)32-3/h7-9,16,26H,5-6,10H2,1-4H3/b13-7+ |
| InChIKey | OFLMTIBDERLLET-NTUHNPAUSA-N |
| XLogP | 1.70 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|