C17H17N3O9 — CID 69248923
2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxyacetic acid (PubChem CID 69248923) has the molecular formula C17H17N3O9 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxyacetic acid.
| Compound Name | 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxyacetic acid |
|---|---|
| PubChem CID | 69248923 |
| Molecular Formula | C17H17N3O9 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenoxy]carbonyloxyacetic acid |
| SMILES | CCN(CC)C(=O)C(C#N)=Cc1cc(OC(=O)OCC(=O)O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O9/c1-3-19(4-2)16(24)11(8-18)5-10-6-12(20(26)27)15(23)13(7-10)29-17(25)28-9-14(21)22/h5-7,23H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | HNRLBDQVWNUAMC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|