C30H27N3O9 — CID 25009051
benzyl [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-phenylmethoxycarbonyloxyphenyl] carbonate (PubChem CID 25009051) has the molecular formula C30H27N3O9 and a molecular weight of 573.56 g/mol. Its IUPAC name is benzyl [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-phenylmethoxycarbonyloxyphenyl] carbonate.
| Compound Name | benzyl [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-phenylmethoxycarbonyloxyphenyl] carbonate |
|---|---|
| PubChem CID | 25009051 |
| Molecular Formula | C30H27N3O9 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | benzyl [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-nitro-6-phenylmethoxycarbonyloxyphenyl] carbonate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)OCc2ccccc2)c(OC(=O)OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H27N3O9/c1-3-32(4-2)28(34)24(18-31)15-23-16-25(33(37)38)27(42-30(36)40-20-22-13-9-6-10-14-22)26(17-23)41-29(35)39-19-21-11-7-5-8-12-21/h5-17H,3-4,19-20H2,1-2H3/b24-15+ |
| InChIKey | BNNDAVNLGMPCJV-BUVRLJJBSA-N |
| XLogP | 5.80 |
| TPSA | 158.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|