C30H27N3O11 — CID 69249029
[4-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenoxy)carbonyloxy-6-nitrophenyl] (4-methoxyphenyl) carbonate (PubChem CID 69249029) has the molecular formula C30H27N3O11 and a molecular weight of 605.56 g/mol. Its IUPAC name is [4-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenoxy)carbonyloxy-6-nitrophenyl] (4-methoxyphenyl) carbonate.
| Compound Name | [4-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenoxy)carbonyloxy-6-nitrophenyl] (4-methoxyphenyl) carbonate |
|---|---|
| PubChem CID | 69249029 |
| Molecular Formula | C30H27N3O11 |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | [4-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenoxy)carbonyloxy-6-nitrophenyl] (4-methoxyphenyl) carbonate |
| SMILES | CCN(CC)C(=O)C(C#N)=Cc1cc(OC(=O)Oc2ccc(OC)cc2)c(OC(=O)Oc2ccc(OC)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H27N3O11/c1-5-32(6-2)28(34)20(18-31)15-19-16-25(33(37)38)27(44-30(36)42-24-13-9-22(40-4)10-14-24)26(17-19)43-29(35)41-23-11-7-21(39-3)8-12-23/h7-17H,5-6H2,1-4H3 |
| InChIKey | SGSUOFJZHFYIPK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 176.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|