C21H21N3O9 — CID 91131695
[5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-hydroxy-2,5-dimethylfuran-3-yl) carbonate (PubChem CID 91131695) has the molecular formula C21H21N3O9 and a molecular weight of 459.41 g/mol. Its IUPAC name is [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-hydroxy-2,5-dimethylfuran-3-yl) carbonate.
| Compound Name | [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-hydroxy-2,5-dimethylfuran-3-yl) carbonate |
|---|---|
| PubChem CID | 91131695 |
| Molecular Formula | C21H21N3O9 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [5-[2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] (4-hydroxy-2,5-dimethylfuran-3-yl) carbonate |
| SMILES | CCN(CC)C(=O)C(C#N)=Cc1cc(OC(=O)Oc2c(C)oc(C)c2O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N3O9/c1-5-23(6-2)20(27)14(10-22)7-13-8-15(24(29)30)18(26)16(9-13)32-21(28)33-19-12(4)31-11(3)17(19)25/h7-9,25-26H,5-6H2,1-4H3 |
| InChIKey | SRLBBOFSRLSSLY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 176.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|