C26H35N3O9 — CID 59720241
[4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(2,2-dimethylpropoxycarbonyloxy)-6-nitrophenyl] 2,2-dimethylpropyl carbonate (PubChem CID 59720241) has the molecular formula C26H35N3O9 and a molecular weight of 533.58 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(2,2-dimethylpropoxycarbonyloxy)-6-nitrophenyl] 2,2-dimethylpropyl carbonate.
| Compound Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(2,2-dimethylpropoxycarbonyloxy)-6-nitrophenyl] 2,2-dimethylpropyl carbonate |
|---|---|
| PubChem CID | 59720241 |
| Molecular Formula | C26H35N3O9 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | [4-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-(2,2-dimethylpropoxycarbonyloxy)-6-nitrophenyl] 2,2-dimethylpropyl carbonate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H35N3O9/c1-9-28(10-2)22(30)18(14-27)11-17-12-19(29(33)34)21(38-24(32)36-16-26(6,7)8)20(13-17)37-23(31)35-15-25(3,4)5/h11-13H,9-10,15-16H2,1-8H3/b18-11+ |
| InChIKey | ZXFLMPPKAOSFJX-WOJGMQOQSA-N |
| XLogP | 5.49 |
| TPSA | 158.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|