C28H23N3O7 — CID 11827362
[2-benzoyloxy-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-3-nitrophenyl] benzoate (PubChem CID 11827362) has the molecular formula C28H23N3O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is [2-benzoyloxy-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-3-nitrophenyl] benzoate.
| Compound Name | [2-benzoyloxy-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-3-nitrophenyl] benzoate |
|---|---|
| PubChem CID | 11827362 |
| Molecular Formula | C28H23N3O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [2-benzoyloxy-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-3-nitrophenyl] benzoate |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23N3O7/c1-3-30(4-2)26(32)22(18-29)15-19-16-23(31(35)36)25(38-28(34)21-13-9-6-10-14-21)24(17-19)37-27(33)20-11-7-5-8-12-20/h5-17H,3-4H2,1-2H3/b22-15+ |
| InChIKey | QUFYNYBJJIWGPB-PXLXIMEGSA-N |
| XLogP | 4.81 |
| TPSA | 139.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|