C25H27N3O7S — CID 143593409
[5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] [phenyl(propylsulfanyl)methyl] carbonate (PubChem CID 143593409) has the molecular formula C25H27N3O7S and a molecular weight of 513.57 g/mol. Its IUPAC name is [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] [phenyl(propylsulfanyl)methyl] carbonate.
| Compound Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] [phenyl(propylsulfanyl)methyl] carbonate |
|---|---|
| PubChem CID | 143593409 |
| Molecular Formula | C25H27N3O7S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxy-3-nitrophenyl] [phenyl(propylsulfanyl)methyl] carbonate |
| SMILES | CCCSC(OC(=O)Oc1cc(/C=C(\C#N)C(=O)N(CC)CC)cc([N+](=O)[O-])c1O)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O7S/c1-4-12-36-24(18-10-8-7-9-11-18)35-25(31)34-21-15-17(14-20(22(21)29)28(32)33)13-19(16-26)23(30)27(5-2)6-3/h7-11,13-15,24,29H,4-6,12H2,1-3H3/b19-13+ |
| InChIKey | RXWOJKSRXXWASQ-CPNJWEJPSA-N |
| XLogP | 5.43 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|