C21H27N3O7 — CID 143593414
ethyl 3-[3-amino-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxyphenoxy]carbonyloxybutanoate (PubChem CID 143593414) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is ethyl 3-[3-amino-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxyphenoxy]carbonyloxybutanoate.
| Compound Name | ethyl 3-[3-amino-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxyphenoxy]carbonyloxybutanoate |
|---|---|
| PubChem CID | 143593414 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | ethyl 3-[3-amino-5-[(E)-2-cyano-3-(diethylamino)-3-oxoprop-1-enyl]-2-hydroxyphenoxy]carbonyloxybutanoate |
| SMILES | CCOC(=O)CC(C)OC(=O)Oc1cc(/C=C(\C#N)C(=O)N(CC)CC)cc(N)c1O |
| InChI | InChI=1S/C21H27N3O7/c1-5-24(6-2)20(27)15(12-22)9-14-10-16(23)19(26)17(11-14)31-21(28)30-13(4)8-18(25)29-7-3/h9-11,13,26H,5-8,23H2,1-4H3/b15-9+ |
| InChIKey | BGMZDBJICSHSJK-OQLLNIDSSA-N |
| XLogP | 2.61 |
| TPSA | 152.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|