C12H11NO7 — CID 67708590
3-[(3,4-dihydroxy-5-nitrophenyl)methylidene]-4-oxopentanoic acid (PubChem CID 67708590) has the molecular formula C12H11NO7 and a molecular weight of 281.22 g/mol. Its IUPAC name is 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene]-4-oxopentanoic acid.
| Compound Name | 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 67708590 |
| Molecular Formula | C12H11NO7 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene]-4-oxopentanoic acid |
| SMILES | CC(=O)C(=Cc1cc(O)c(O)c([N+](=O)[O-])c1)CC(=O)O |
| InChI | InChI=1S/C12H11NO7/c1-6(14)8(5-11(16)17)2-7-3-9(13(19)20)12(18)10(15)4-7/h2-4,15,18H,5H2,1H3,(H,16,17) |
| InChIKey | OBPABFPANAGDBG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|