C9H7NO6 — CID 10105070
(Z)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid (PubChem CID 10105070) has the molecular formula C9H7NO6 and a molecular weight of 225.16 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 10105070 |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C\c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7NO6/c11-7-4-5(1-2-8(12)13)3-6(9(7)14)10(15)16/h1-4,11,14H,(H,12,13)/b2-1- |
| InChIKey | WIGNVYQMAXKHTQ-UPHRSURJSA-N |
| XLogP | 1.10 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|