C17H15NO6 — CID 75073984
2-phenylethyl 3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate (PubChem CID 75073984) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-phenylethyl 3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate.
| Compound Name | 2-phenylethyl 3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 75073984 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-phenylethyl 3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cc(O)c(O)c([N+](=O)[O-])c1)OCCc1ccccc1 |
| InChI | InChI=1S/C17H15NO6/c19-15-11-13(10-14(17(15)21)18(22)23)6-7-16(20)24-9-8-12-4-2-1-3-5-12/h1-7,10-11,19,21H,8-9H2 |
| InChIKey | WIKOXWOZNIRBTH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|