C17H16O4 — CID 102321719
2-phenylethyl (E)-3-(2,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 102321719) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-phenylethyl (E)-3-(2,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 2-phenylethyl (E)-3-(2,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102321719 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-phenylethyl (E)-3-(2,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1O)OCCc1ccccc1 |
| InChI | InChI=1S/C17H16O4/c18-15-8-6-14(16(19)12-15)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
| InChIKey | UMRRXTOTJXDMOX-VQHVLOKHSA-N |
| XLogP | 2.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|