C34H32O8 — CID 175919948
(2E)-2-[(3,4-dihydroxyphenyl)methylidene]-4-phenylbutanoic acid;2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 175919948) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-4-phenylbutanoic acid;2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-4-phenylbutanoic acid;2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 175919948 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-4-phenylbutanoic acid;2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCCc1ccccc1.O=C(O)/C(=C/c1ccc(O)c(O)c1)CCc1ccccc1 |
| InChI | InChI=1S/2C17H16O4/c18-15-9-7-13(11-16(15)19)10-14(17(20)21)8-6-12-4-2-1-3-5-12;18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-5,7,9-11,18-19H,6,8H2,(H,20,21);1-9,12,18-19H,10-11H2/b14-10+;9-7+ |
| InChIKey | DWAVXNDZPHPYTA-WJTRIQIYSA-N |
| XLogP | 6.10 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|