C18H18O3 — CID 14407195
(E)-1-(3,4-dihydroxyphenyl)-6-phenylhex-1-en-3-one (PubChem CID 14407195) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-1-(3,4-dihydroxyphenyl)-6-phenylhex-1-en-3-one.
| Compound Name | (E)-1-(3,4-dihydroxyphenyl)-6-phenylhex-1-en-3-one |
|---|---|
| PubChem CID | 14407195 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (E)-1-(3,4-dihydroxyphenyl)-6-phenylhex-1-en-3-one |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)CCCc1ccccc1 |
| InChI | InChI=1S/C18H18O3/c19-16(8-4-7-14-5-2-1-3-6-14)11-9-15-10-12-17(20)18(21)13-15/h1-3,5-6,9-13,20-21H,4,7-8H2/b11-9+ |
| InChIKey | BKOOGPJYPVGVMG-PKNBQFBNSA-N |
| XLogP | 3.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|