C18H16O7 — CID 72545181
3-[2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxyethyl]benzoic acid (PubChem CID 72545181) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 3-[2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxyethyl]benzoic acid.
| Compound Name | 3-[2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxyethyl]benzoic acid |
|---|---|
| PubChem CID | 72545181 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxyethyl]benzoic acid |
| SMILES | O=C(/C=C/c1cc(O)c(O)c(O)c1)OCCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H16O7/c19-14-9-12(10-15(20)17(14)22)4-5-16(21)25-7-6-11-2-1-3-13(8-11)18(23)24/h1-5,8-10,19-20,22H,6-7H2,(H,23,24)/b5-4+ |
| InChIKey | ZSGWVUUURGYCIK-SNAWJCMRSA-N |
| XLogP | 2.30 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|