C15H11NO6 — CID 18990388
(E)-3-(3,4-dihydroxy-5-nitrophenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 18990388) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxy-5-nitrophenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dihydroxy-5-nitrophenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18990388 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (E)-3-(3,4-dihydroxy-5-nitrophenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(O)c(O)c([N+](=O)[O-])c1)c1ccccc1O |
| InChI | InChI=1S/C15H11NO6/c17-12-4-2-1-3-10(12)13(18)6-5-9-7-11(16(21)22)15(20)14(19)8-9/h1-8,17,19-20H/b6-5+ |
| InChIKey | WMVQYGLKWBXMMT-AATRIKPKSA-N |
| XLogP | 2.61 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|