C10H7N3O5 — CID 18990391
(E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide (PubChem CID 18990391) has the molecular formula C10H7N3O5 and a molecular weight of 249.18 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18990391 |
| Molecular Formula | C10H7N3O5 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c([N+](=O)[O-])c1)C(N)=O |
| InChI | InChI=1S/C10H7N3O5/c11-4-6(10(12)16)1-5-2-7(13(17)18)9(15)8(14)3-5/h1-3,14-15H,(H2,12,16)/b6-1+ |
| InChIKey | IZXCSWDOAKESAA-LZCJLJQNSA-N |
| XLogP | 0.40 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|