C13H8N4O6 — CID 162168737
(E)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(2-oxo-1,5-dihydroimidazole-4-carbonyl)prop-2-enenitrile (PubChem CID 162168737) has the molecular formula C13H8N4O6 and a molecular weight of 316.23 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(2-oxo-1,5-dihydroimidazole-4-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(2-oxo-1,5-dihydroimidazole-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 162168737 |
| Molecular Formula | C13H8N4O6 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (E)-3-(3,4-dihydroxy-5-nitrophenyl)-2-(2-oxo-1,5-dihydroimidazole-4-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(O)c(O)c([N+](=O)[O-])c1)C(=O)C1=NC(=O)NC1 |
| InChI | InChI=1S/C13H8N4O6/c14-4-7(11(19)8-5-15-13(21)16-8)1-6-2-9(17(22)23)12(20)10(18)3-6/h1-3,18,20H,5H2,(H,15,21)/b7-1+ |
| InChIKey | ZNMPEPZWPKIXMZ-LREOWRDNSA-N |
| XLogP | 0.65 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|