C16H10F3N3O5 — CID 67037476
3-(3,4-dihydroxy-5-nitrophenyl)-2-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile (PubChem CID 67037476) has the molecular formula C16H10F3N3O5 and a molecular weight of 381.27 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-5-nitrophenyl)-2-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile.
| Compound Name | 3-(3,4-dihydroxy-5-nitrophenyl)-2-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 67037476 |
| Molecular Formula | C16H10F3N3O5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-(3,4-dihydroxy-5-nitrophenyl)-2-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]prop-2-enenitrile |
| SMILES | Cc1c(C(C#N)=Cc2cc(O)c(O)c([N+](=O)[O-])c2)ccc(C(F)(F)F)[n+]1[O-] |
| InChI | InChI=1S/C16H10F3N3O5/c1-8-11(2-3-14(21(8)25)16(17,18)19)10(7-20)4-9-5-12(22(26)27)15(24)13(23)6-9/h2-6,23-24H,1H3 |
| InChIKey | OUYHNBZZJGKFHK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|