C23H13F3N2O5 — CID 2235333
4-[(Z)-1-cyano-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]benzoic acid (PubChem CID 2235333) has the molecular formula C23H13F3N2O5 and a molecular weight of 454.36 g/mol. Its IUPAC name is 4-[(Z)-1-cyano-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(Z)-1-cyano-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 2235333 |
| Molecular Formula | C23H13F3N2O5 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-[(Z)-1-cyano-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H13F3N2O5/c24-23(25,26)18-7-10-21(20(12-18)28(31)32)33-19-8-1-14(2-9-19)11-17(13-27)15-3-5-16(6-4-15)22(29)30/h1-12H,(H,29,30)/b17-11+ |
| InChIKey | LHCGJIUUEBLOMF-GZTJUZNOSA-N |
| XLogP | 6.17 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|