C26H19F3N2O4 — CID 126089549
(Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]-2-phenylprop-2-enenitrile (PubChem CID 126089549) has the molecular formula C26H19F3N2O4 and a molecular weight of 480.44 g/mol. Its IUPAC name is (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126089549 |
| Molecular Formula | C26H19F3N2O4 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]-2-phenylprop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(\C#N)c2ccccc2)cc(OC)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19F3N2O4/c1-3-7-19-12-17(13-20(16-30)18-8-5-4-6-9-18)14-24(34-2)25(19)35-23-11-10-21(26(27,28)29)15-22(23)31(32)33/h3-6,8-15H,1,7H2,2H3/b20-13+ |
| InChIKey | UQLRRKLNSJPIQN-DEDYPNTBSA-N |
| XLogP | 7.21 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|