C26H16F3N5O5S — CID 4217181
N-[5-[1-cyano-2-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4217181) has the molecular formula C26H16F3N5O5S and a molecular weight of 567.51 g/mol. Its IUPAC name is N-[5-[1-cyano-2-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[1-cyano-2-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4217181 |
| Molecular Formula | C26H16F3N5O5S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | N-[5-[1-cyano-2-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cc(C=C(C#N)c2nnc(NC(=O)c3ccccc3)s2)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H16F3N5O5S/c1-38-22-12-15(7-9-21(22)39-20-10-8-18(26(27,28)29)13-19(20)34(36)37)11-17(14-30)24-32-33-25(40-24)31-23(35)16-5-3-2-4-6-16/h2-13H,1H3,(H,31,33,35) |
| InChIKey | HDLWJZXJHHVLRA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|