C22H14FN3O6 — CID 126398221
(E)-3-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398221) has the molecular formula C22H14FN3O6 and a molecular weight of 435.37 g/mol. Its IUPAC name is (E)-3-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398221 |
| Molecular Formula | C22H14FN3O6 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (E)-3-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14FN3O6/c1-31-22-10-14(9-16(13-24)15-3-2-4-17(23)11-15)5-7-21(22)32-20-8-6-18(25(27)28)12-19(20)26(29)30/h2-12H,1H3/b16-9- |
| InChIKey | RYVUGACULTUVDQ-SXGWCWSVSA-N |
| XLogP | 5.51 |
| TPSA | 128.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|