C21H13F3N2O4S — CID 11561380
(Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 11561380) has the molecular formula C21H13F3N2O4S and a molecular weight of 446.41 g/mol. Its IUPAC name is (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 11561380 |
| Molecular Formula | C21H13F3N2O4S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (Z)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccs2)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H13F3N2O4S/c1-29-19-10-13(9-14(12-25)20-3-2-8-31-20)4-6-18(19)30-17-7-5-15(21(22,23)24)11-16(17)26(27)28/h2-11H,1H3/b14-9- |
| InChIKey | OIUDFTWFRZMDLL-ZROIWOOFSA-N |
| XLogP | 6.54 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|