C21H14BrF3N2O5 — CID 16761451
N-(3-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 16761451) has the molecular formula C21H14BrF3N2O5 and a molecular weight of 511.25 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | N-(3-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 16761451 |
| Molecular Formula | C21H14BrF3N2O5 |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | N-(3-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(Br)c2)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14BrF3N2O5/c1-31-19-9-12(20(28)26-15-4-2-3-14(22)11-15)5-7-18(19)32-17-8-6-13(21(23,24)25)10-16(17)27(29)30/h2-11H,1H3,(H,26,28) |
| InChIKey | JNHONTLHCZPTJP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|